C15H20O4 — CID 14074736
2-[(4R,5S)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]acetaldehyde (PubChem CID 14074736) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[(4R,5S)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]acetaldehyde.
| Compound Name | 2-[(4R,5S)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 14074736 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[(4R,5S)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]acetaldehyde |
| SMILES | COc1ccccc1[C@@H]1OC(C)(C)OC[C@@H]1CC=O |
| InChI | InChI=1S/C15H20O4/c1-15(2)18-10-11(8-9-16)14(19-15)12-6-4-5-7-13(12)17-3/h4-7,9,11,14H,8,10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | LJYLEPUOIMUOQO-SMDDNHRTSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|