C21H30O5 — CID 54038000
8-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]oct-6-enoic acid (PubChem CID 54038000) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 8-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]oct-6-enoic acid.
| Compound Name | 8-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]oct-6-enoic acid |
|---|---|
| PubChem CID | 54038000 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 8-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]oct-6-enoic acid |
| SMILES | COc1ccccc1[C@H]1OC(C)(C)OC[C@H]1CC=CCCCCC(=O)O |
| InChI | InChI=1S/C21H30O5/c1-21(2)25-15-16(11-7-5-4-6-8-14-19(22)23)20(26-21)17-12-9-10-13-18(17)24-3/h5,7,9-10,12-13,16,20H,4,6,8,11,14-15H2,1-3H3,(H,22,23)/t16-,20+/m1/s1 |
| InChIKey | LKIJUXYFYWQTMR-UZLBHIALSA-N |
| XLogP | 4.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|