C16H26O4S — CID 54352066
7-[(3R,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)thiolan-3-yl]hept-5-enoic acid (PubChem CID 54352066) has the molecular formula C16H26O4S and a molecular weight of 314.45 g/mol. Its IUPAC name is 7-[(3R,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)thiolan-3-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)thiolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54352066 |
| Molecular Formula | C16H26O4S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 7-[(3R,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)thiolan-3-yl]hept-5-enoic acid |
| SMILES | CC1(C)OCC([C@@H]2CSC[C@@H]2CC=CCCCC(=O)O)O1 |
| InChI | InChI=1S/C16H26O4S/c1-16(2)19-9-14(20-16)13-11-21-10-12(13)7-5-3-4-6-8-15(17)18/h3,5,12-14H,4,6-11H2,1-2H3,(H,17,18)/t12-,13+,14?/m0/s1 |
| InChIKey | UGLVXJPDTZSLLF-WLDKUNSKSA-N |
| XLogP | 3.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|