C18H30O2S2 — CID 54421378
7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)thiolan-3-yl]hept-5-enoic acid (PubChem CID 54421378) has the molecular formula C18H30O2S2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)thiolan-3-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)thiolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54421378 |
| Molecular Formula | C18H30O2S2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)thiolan-3-yl]hept-5-enoic acid |
| SMILES | CCCC=CCSC[C@@H]1CSC[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C18H30O2S2/c1-2-3-4-9-12-21-14-17-15-22-13-16(17)10-7-5-6-8-11-18(19)20/h4-5,7,9,16-17H,2-3,6,8,10-15H2,1H3,(H,19,20)/t16-,17+/m0/s1 |
| InChIKey | WBAQKCYJXULIFA-DLBZAZTESA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|