(E)-undec-7-enoic acid

C11H20O2 — CID 5312729

IUPAC(E)-undec-7-enoic acid
SMILESCCC/C=C/CCCCCC(=O)O
InChIInChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h4-5H,2-3,6-10H2,1H3,(H,12,13)/b5-4+
InChIKeyNNARBTBSQBNUGJ-SNAWJCMRSA-N
MW184.28 g/mol
LogP3.38
Rot. Bonds8

About (E)-undec-7-enoic acid

(E)-undec-7-enoic acid (PubChem CID 5312729) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-undec-7-enoic acid.

Molecular Properties

Compound Name(E)-undec-7-enoic acid
PubChem CID5312729
Molecular FormulaC11H20O2
Molecular Weight184.28 g/mol
Exact Mass184.15
IUPAC Name(E)-undec-7-enoic acid
SMILESCCC/C=C/CCCCCC(=O)O
InChIInChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h4-5H,2-3,6-10H2,1H3,(H,12,13)/b5-4+
InChIKeyNNARBTBSQBNUGJ-SNAWJCMRSA-N
XLogP3.38
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.28
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-undec-7-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-undec-7-enoic acid?
The IUPAC name of (E)-undec-7-enoic acid (CID 5312729) is (E)-undec-7-enoic acid.
What is the SMILES notation for (E)-undec-7-enoic acid?
The canonical SMILES for (E)-undec-7-enoic acid is CCC/C=C/CCCCCC(=O)O.
What is the InChIKey of (E)-undec-7-enoic acid?
The InChIKey is NNARBTBSQBNUGJ-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h4-5H,2-3,6-10H2,1H3,(H,12,13)/b5-4+.
What are the key properties of (E)-undec-7-enoic acid?
(E)-undec-7-enoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.38, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-undec-7-enoic acid is sourced from PubChem (CID 5312729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).