C16H28O2 — CID 87441116
(9Z)-hexadeca-9,12-dienoic acid (PubChem CID 87441116) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (9Z)-hexadeca-9,12-dienoic acid.
| Compound Name | (9Z)-hexadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 87441116 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (9Z)-hexadeca-9,12-dienoic acid |
| SMILES | CCCC=CC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h4-5,7-8H,2-3,6,9-15H2,1H3,(H,17,18)/b5-4?,8-7- |
| InChIKey | RVEKLXYYCHAMDF-JCHHLDFQSA-N |
| XLogP | 5.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|