C18H28O3S — CID 70484782
7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)oxolan-3-yl]hepta-2,5-dienoic acid (PubChem CID 70484782) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)oxolan-3-yl]hepta-2,5-dienoic acid.
| Compound Name | 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)oxolan-3-yl]hepta-2,5-dienoic acid |
|---|---|
| PubChem CID | 70484782 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 7-[(3R,4S)-4-(hex-2-enylsulfanylmethyl)oxolan-3-yl]hepta-2,5-dienoic acid |
| SMILES | CCCC=CCSC[C@@H]1COC[C@@H]1CC=CCC=CC(=O)O |
| InChI | InChI=1S/C18H28O3S/c1-2-3-4-9-12-22-15-17-14-21-13-16(17)10-7-5-6-8-11-18(19)20/h4-5,7-9,11,16-17H,2-3,6,10,12-15H2,1H3,(H,19,20)/t16-,17-/m0/s1 |
| InChIKey | QKWPIVUUZHTJLS-IRXDYDNUSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|