C23H23F3O5 — CID 59396903
(Z)-6-[(2S,4S,5R)-4-(2-methoxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 59396903) has the molecular formula C23H23F3O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-4-(2-methoxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-4-(2-methoxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 59396903 |
| Molecular Formula | C23H23F3O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-4-(2-methoxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | COc1ccccc1[C@H]1O[C@@H](c2cc(F)c(F)c(F)c2)OC[C@H]1C/C=C\CCC(=O)O |
| InChI | InChI=1S/C23H23F3O5/c1-29-19-9-6-5-8-16(19)22-14(7-3-2-4-10-20(27)28)13-30-23(31-22)15-11-17(24)21(26)18(25)12-15/h2-3,5-6,8-9,11-12,14,22-23H,4,7,10,13H2,1H3,(H,27,28)/b3-2-/t14-,22+,23+/m1/s1 |
| InChIKey | ODURWOXADMREIE-ZOXNIDCJSA-N |
| XLogP | 5.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|