C22H22Cl2O5 — CID 75965547
6-[2-(2,3-dichlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 75965547) has the molecular formula C22H22Cl2O5 and a molecular weight of 437.32 g/mol. Its IUPAC name is 6-[2-(2,3-dichlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[2-(2,3-dichlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 75965547 |
| Molecular Formula | C22H22Cl2O5 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 6-[2-(2,3-dichlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CCC1COC(c2cccc(Cl)c2Cl)OC1c1ccccc1O |
| InChI | InChI=1S/C22H22Cl2O5/c23-17-10-6-9-16(20(17)24)22-28-13-14(7-2-1-3-12-19(26)27)21(29-22)15-8-4-5-11-18(15)25/h1-2,4-6,8-11,14,21-22,25H,3,7,12-13H2,(H,26,27) |
| InChIKey | PNPJJFJDDHOOKH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|