C20H22O6 — CID 70390766
(Z)-6-[2-(furan-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 70390766) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (Z)-6-[2-(furan-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[2-(furan-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 70390766 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (Z)-6-[2-(furan-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC1COC(c2ccoc2)OC1c1ccccc1O |
| InChI | InChI=1S/C20H22O6/c21-17-8-5-4-7-16(17)19-14(6-2-1-3-9-18(22)23)13-25-20(26-19)15-10-11-24-12-15/h1-2,4-5,7-8,10-12,14,19-21H,3,6,9,13H2,(H,22,23)/b2-1- |
| InChIKey | VCBVGMOASMDWLO-UPHRSURJSA-N |
| XLogP | 4.20 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|