C34H33NO5 — CID 74385262
6-[4-(2-hydroxyphenyl)-2-[4-(N-phenylanilino)phenyl]-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 74385262) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is 6-[4-(2-hydroxyphenyl)-2-[4-(N-phenylanilino)phenyl]-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[4-(2-hydroxyphenyl)-2-[4-(N-phenylanilino)phenyl]-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 74385262 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 6-[4-(2-hydroxyphenyl)-2-[4-(N-phenylanilino)phenyl]-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CCC1COC(c2ccc(N(c3ccccc3)c3ccccc3)cc2)OC1c1ccccc1O |
| InChI | InChI=1S/C34H33NO5/c36-31-18-11-10-17-30(31)33-26(12-4-1-9-19-32(37)38)24-39-34(40-33)25-20-22-29(23-21-25)35(27-13-5-2-6-14-27)28-15-7-3-8-16-28/h1-8,10-11,13-18,20-23,26,33-34,36H,9,12,19,24H2,(H,37,38) |
| InChIKey | RMNGRHYSSHTDEX-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|