C26H26ClNO5 — CID 91581566
6-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 91581566) has the molecular formula C26H26ClNO5 and a molecular weight of 467.95 g/mol. Its IUPAC name is 6-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 91581566 |
| Molecular Formula | C26H26ClNO5 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 6-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | Cc1ccc2nc(Cl)c([C@H]3OC[C@@H](CC=CCCC(=O)O)[C@@H](c4ccccc4O)O3)cc2c1 |
| InChI | InChI=1S/C26H26ClNO5/c1-16-11-12-21-18(13-16)14-20(25(27)28-21)26-32-15-17(7-3-2-4-10-23(30)31)24(33-26)19-8-5-6-9-22(19)29/h2-3,5-6,8-9,11-14,17,24,26,29H,4,7,10,15H2,1H3,(H,30,31)/t17-,24+,26+/m1/s1 |
| InChIKey | VWWQXSVTIHFTES-JWFGRAFASA-N |
| XLogP | 6.12 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|