C26H28ClNO3 — CID 88980399
2-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-5-[(Z)-hex-2-enyl]-1,3-dioxan-4-yl]phenol (PubChem CID 88980399) has the molecular formula C26H28ClNO3 and a molecular weight of 437.97 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-5-[(Z)-hex-2-enyl]-1,3-dioxan-4-yl]phenol.
| Compound Name | 2-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-5-[(Z)-hex-2-enyl]-1,3-dioxan-4-yl]phenol |
|---|---|
| PubChem CID | 88980399 |
| Molecular Formula | C26H28ClNO3 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[(2S,4S,5R)-2-(2-chloro-6-methylquinolin-3-yl)-5-[(Z)-hex-2-enyl]-1,3-dioxan-4-yl]phenol |
| SMILES | CCC/C=C\C[C@@H]1CO[C@H](c2cc3cc(C)ccc3nc2Cl)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C26H28ClNO3/c1-3-4-5-6-9-18-16-30-26(31-24(18)20-10-7-8-11-23(20)29)21-15-19-14-17(2)12-13-22(19)28-25(21)27/h5-8,10-15,18,24,26,29H,3-4,9,16H2,1-2H3/b6-5-/t18-,24+,26+/m1/s1 |
| InChIKey | CWZPNGLTQNRDPX-QZFXCRJGSA-N |
| XLogP | 7.05 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|