About 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane
3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane (PubChem CID 134686657) has the molecular formula C25H24ClNO3
and a molecular weight of 421.92 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane.
Molecular Properties
| Compound Name | 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane |
| PubChem CID | 134686657 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane |
| SMILES | C.COc1cc(O)cc(OCc2cc3cccc(C)c3nc2-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H20ClNO3.CH4/c1-15-6-5-7-16-10-17(14-29-20-12-18(27)11-19(13-20)28-2)24(26-23(15)16)21-8-3-4-9-22(21)25;/h3-13,27H,14H2,1-2H3;1H4 |
| InChIKey | YWCXHQDDYITIEQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane?
The IUPAC name of 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane (CID 134686657) is 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane.
What is the SMILES notation for 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane?
The canonical SMILES for 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane is C.COc1cc(O)cc(OCc2cc3cccc(C)c3nc2-c2ccccc2Cl)c1.
What is the InChIKey of 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane?
The InChIKey is YWCXHQDDYITIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClNO3.CH4/c1-15-6-5-7-16-10-17(14-29-20-12-18(27)11-19(13-20)28-2)24(26-23(15)16)21-8-3-4-9-22(21)25;/h3-13,27H,14H2,1-2H3;1H4.
What are the key properties of 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane?
3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane has a molecular weight of 421.92 g/mol, XLogP of 6.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2-chlorophenyl)-8-methylquinolin-3-yl]methoxy]-5-methoxyphenol;methane is sourced from PubChem (CID 134686657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).