C23H25ClO5 — CID 58360158
(Z)-7-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hept-5-enoic acid (PubChem CID 58360158) has the molecular formula C23H25ClO5 and a molecular weight of 416.90 g/mol. Its IUPAC name is (Z)-7-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58360158 |
| Molecular Formula | C23H25ClO5 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (Z)-7-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1CO[C@H](c2ccccc2Cl)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C23H25ClO5/c24-19-12-7-5-10-17(19)23-28-15-16(9-3-1-2-4-14-21(26)27)22(29-23)18-11-6-8-13-20(18)25/h1,3,5-8,10-13,16,22-23,25H,2,4,9,14-15H2,(H,26,27)/b3-1-/t16-,22+,23+/m1/s1 |
| InChIKey | MMNIBCYAIIJADC-YURAOWGRSA-N |
| XLogP | 5.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|