C22H23FO5 — CID 91232915
6-[(4S,5R)-2-(2-fluorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 91232915) has the molecular formula C22H23FO5 and a molecular weight of 386.42 g/mol. Its IUPAC name is 6-[(4S,5R)-2-(2-fluorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[(4S,5R)-2-(2-fluorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 91232915 |
| Molecular Formula | C22H23FO5 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 6-[(4S,5R)-2-(2-fluorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CC[C@@H]1COC(c2ccccc2F)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C22H23FO5/c23-18-11-6-4-9-16(18)22-27-14-15(8-2-1-3-13-20(25)26)21(28-22)17-10-5-7-12-19(17)24/h1-2,4-7,9-12,15,21-22,24H,3,8,13-14H2,(H,25,26)/t15-,21+,22?/m1/s1 |
| InChIKey | CLNYCDPKWOCTKN-XLRMLUQGSA-N |
| XLogP | 4.75 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|