C20H19ClO5 — CID 91251099
4-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]but-2-enoic acid (PubChem CID 91251099) has the molecular formula C20H19ClO5 and a molecular weight of 374.82 g/mol. Its IUPAC name is 4-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]but-2-enoic acid.
| Compound Name | 4-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 91251099 |
| Molecular Formula | C20H19ClO5 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-[(2S,4S,5R)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]but-2-enoic acid |
| SMILES | O=C(O)C=CC[C@@H]1CO[C@H](c2ccccc2Cl)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C20H19ClO5/c21-16-9-3-1-7-14(16)20-25-12-13(6-5-11-18(23)24)19(26-20)15-8-2-4-10-17(15)22/h1-5,7-11,13,19-20,22H,6,12H2,(H,23,24)/t13-,19+,20+/m1/s1 |
| InChIKey | DHECWLPXONQYHU-CWVNLOTRSA-N |
| XLogP | 4.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|