C12H16O4 — CID 18645650
(4R)-4-(2-methoxyphenoxy)-2,2-dimethyl-1,3-dioxolane (PubChem CID 18645650) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (4R)-4-(2-methoxyphenoxy)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-(2-methoxyphenoxy)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 18645650 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (4R)-4-(2-methoxyphenoxy)-2,2-dimethyl-1,3-dioxolane |
| SMILES | COc1ccccc1O[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H16O4/c1-12(2)14-8-11(16-12)15-10-7-5-4-6-9(10)13-3/h4-7,11H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | UQJIWSCKZLHKGD-LLVKDONJSA-N |
| XLogP | 2.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |