C19H25NO4S — CID 67929197
(Z)-6-[3-(benzenesulfonamido)-1-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 67929197) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is (Z)-6-[3-(benzenesulfonamido)-1-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[3-(benzenesulfonamido)-1-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 67929197 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (Z)-6-[3-(benzenesulfonamido)-1-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C12CCC(C1)C(NS(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C19H25NO4S/c21-18(22)9-5-2-6-11-19-12-10-15(13-19)17(14-19)20-25(23,24)16-7-3-1-4-8-16/h1,3-4,6-8,11,15,17,20H,2,5,9-10,12-14H2,(H,21,22)/b11-6- |
| InChIKey | QNPHRNBLBYWMCA-WDZFZDKYSA-N |
| XLogP | 3.33 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|