C18H25NO4S — CID 67905182
(Z)-6-[1-[(3-methylphenyl)sulfonylamino]cyclopentyl]hex-5-enoic acid (PubChem CID 67905182) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is (Z)-6-[1-[(3-methylphenyl)sulfonylamino]cyclopentyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[1-[(3-methylphenyl)sulfonylamino]cyclopentyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 67905182 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (Z)-6-[1-[(3-methylphenyl)sulfonylamino]cyclopentyl]hex-5-enoic acid |
| SMILES | Cc1cccc(S(=O)(=O)NC2(/C=C\CCCC(=O)O)CCCC2)c1 |
| InChI | InChI=1S/C18H25NO4S/c1-15-8-7-9-16(14-15)24(22,23)19-18(12-5-6-13-18)11-4-2-3-10-17(20)21/h4,7-9,11,14,19H,2-3,5-6,10,12-13H2,1H3,(H,20,21)/b11-4- |
| InChIKey | HWTNVASZKZVEQI-WCIBSUBMSA-N |
| XLogP | 3.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|