C19H27ClNNaO4S — CID 173348194
sodium;(Z)-8-[1-[(4-chlorophenyl)sulfonylamino]cyclopentyl]oct-5-enoic acid;hydride (PubChem CID 173348194) has the molecular formula C19H27ClNNaO4S and a molecular weight of 423.94 g/mol. Its IUPAC name is sodium;(Z)-8-[1-[(4-chlorophenyl)sulfonylamino]cyclopentyl]oct-5-enoic acid;hydride.
| Compound Name | sodium;(Z)-8-[1-[(4-chlorophenyl)sulfonylamino]cyclopentyl]oct-5-enoic acid;hydride |
|---|---|
| PubChem CID | 173348194 |
| Molecular Formula | C19H27ClNNaO4S |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | sodium;(Z)-8-[1-[(4-chlorophenyl)sulfonylamino]cyclopentyl]oct-5-enoic acid;hydride |
| SMILES | O=C(O)CCC/C=C\CCC1(NS(=O)(=O)c2ccc(Cl)cc2)CCCC1.[H-].[Na+] |
| InChI | InChI=1S/C19H26ClNO4S.Na.H/c20-16-9-11-17(12-10-16)26(24,25)21-19(14-6-7-15-19)13-5-3-1-2-4-8-18(22)23;;/h1,3,9-12,21H,2,4-8,13-15H2,(H,22,23);;/q;+1;-1/b3-1-;; |
| InChIKey | MQHJXKBABWJSLC-KUGGNXEISA-N |
| XLogP | 1.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|