C13H15ClNO4S- — CID 4252683
1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 4252683) has the molecular formula C13H15ClNO4S- and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | 1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4252683 |
| Molecular Formula | C13H15ClNO4S- |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1(NS(=O)(=O)c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C13H16ClNO4S/c14-10-4-6-11(7-5-10)20(18,19)15-13(12(16)17)8-2-1-3-9-13/h4-7,15H,1-3,8-9H2,(H,16,17)/p-1 |
| InChIKey | PCSNDUHMIZCBDH-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |