C20H21Cl2NO3S — CID 10387732
N-[1-(3,5-dichlorobenzoyl)cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 10387732) has the molecular formula C20H21Cl2NO3S and a molecular weight of 426.37 g/mol. Its IUPAC name is N-[1-(3,5-dichlorobenzoyl)cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(3,5-dichlorobenzoyl)cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10387732 |
| Molecular Formula | C20H21Cl2NO3S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[1-(3,5-dichlorobenzoyl)cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2(C(=O)c3cc(Cl)cc(Cl)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3S/c1-14-5-7-18(8-6-14)27(25,26)23-20(9-3-2-4-10-20)19(24)15-11-16(21)13-17(22)12-15/h5-8,11-13,23H,2-4,9-10H2,1H3 |
| InChIKey | HBCDFKBUHUQANU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |