C14H16ClNO2S — CID 134103778
4-chloro-N-(1-ethynylcyclohexyl)benzenesulfonamide (PubChem CID 134103778) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-chloro-N-(1-ethynylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(1-ethynylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134103778 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-chloro-N-(1-ethynylcyclohexyl)benzenesulfonamide |
| SMILES | C#CC1(NS(=O)(=O)c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C14H16ClNO2S/c1-2-14(10-4-3-5-11-14)16-19(17,18)13-8-6-12(15)7-9-13/h1,6-9,16H,3-5,10-11H2 |
| InChIKey | DQAQMRDYRVTOKF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|