C12H11FN2O3S — CID 169187126
5-[(1-ethynylcyclopropyl)sulfamoyl]-2-fluorobenzamide (PubChem CID 169187126) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[(1-ethynylcyclopropyl)sulfamoyl]-2-fluorobenzamide.
| Compound Name | 5-[(1-ethynylcyclopropyl)sulfamoyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 169187126 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-[(1-ethynylcyclopropyl)sulfamoyl]-2-fluorobenzamide |
| SMILES | C#CC1(NS(=O)(=O)c2ccc(F)c(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C12H11FN2O3S/c1-2-12(5-6-12)15-19(17,18)8-3-4-10(13)9(7-8)11(14)16/h1,3-4,7,15H,5-6H2,(H2,14,16) |
| InChIKey | UAKPFHDRXMDXID-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|