C16H15FN2O4S2 — CID 71859514
2-fluoro-5-[[2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]sulfamoyl]benzamide (PubChem CID 71859514) has the molecular formula C16H15FN2O4S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-fluoro-5-[[2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]sulfamoyl]benzamide.
| Compound Name | 2-fluoro-5-[[2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 71859514 |
| Molecular Formula | C16H15FN2O4S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-fluoro-5-[[2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]sulfamoyl]benzamide |
| SMILES | Cc1ccc(C2CC2C(=O)NS(=O)(=O)c2ccc(F)c(C(N)=O)c2)s1 |
| InChI | InChI=1S/C16H15FN2O4S2/c1-8-2-5-14(24-8)10-7-11(10)16(21)19-25(22,23)9-3-4-13(17)12(6-9)15(18)20/h2-6,10-11H,7H2,1H3,(H2,18,20)(H,19,21) |
| InChIKey | DZGMETZFTYNTKL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |