C17H14F4N2O4S — CID 71859517
2-fluoro-5-[(4,4,4-trifluoro-3-phenylbutanoyl)sulfamoyl]benzamide (PubChem CID 71859517) has the molecular formula C17H14F4N2O4S and a molecular weight of 418.37 g/mol. Its IUPAC name is 2-fluoro-5-[(4,4,4-trifluoro-3-phenylbutanoyl)sulfamoyl]benzamide.
| Compound Name | 2-fluoro-5-[(4,4,4-trifluoro-3-phenylbutanoyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 71859517 |
| Molecular Formula | C17H14F4N2O4S |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-fluoro-5-[(4,4,4-trifluoro-3-phenylbutanoyl)sulfamoyl]benzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)NC(=O)CC(c2ccccc2)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C17H14F4N2O4S/c18-14-7-6-11(8-12(14)16(22)25)28(26,27)23-15(24)9-13(17(19,20)21)10-4-2-1-3-5-10/h1-8,13H,9H2,(H2,22,25)(H,23,24) |
| InChIKey | LJWNBRPSJJLBHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |