C11H12F2N2O3S — CID 169187237
2-fluoro-5-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]benzamide (PubChem CID 169187237) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-fluoro-5-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]benzamide.
| Compound Name | 2-fluoro-5-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 169187237 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-fluoro-5-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]benzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)NC2(CF)CC2)ccc1F |
| InChI | InChI=1S/C11H12F2N2O3S/c12-6-11(3-4-11)15-19(17,18)7-1-2-9(13)8(5-7)10(14)16/h1-2,5,15H,3-4,6H2,(H2,14,16) |
| InChIKey | CTKMUUUDUJCKAR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |