C19H18F3NO3 — CID 119165660
3-phenyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]propanoic acid (PubChem CID 119165660) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-phenyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]propanoic acid.
| Compound Name | 3-phenyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119165660 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-phenyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]propanoic acid |
| SMILES | O=C(CC(c1ccccc1)C(F)(F)F)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H18F3NO3/c20-19(21,22)15(14-9-5-2-6-10-14)12-17(24)23-16(18(25)26)11-13-7-3-1-4-8-13/h1-10,15-16H,11-12H2,(H,23,24)(H,25,26) |
| InChIKey | WVPIDYUVAYDNQA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |