C16H18F3NO3 — CID 120693330
(E)-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]hex-4-enoic acid (PubChem CID 120693330) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is (E)-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693330 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (E)-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CC(c1ccccc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H18F3NO3/c1-2-3-9-13(15(22)23)20-14(21)10-12(16(17,18)19)11-7-5-4-6-8-11/h2-8,12-13H,9-10H2,1H3,(H,20,21)(H,22,23)/b3-2+ |
| InChIKey | HRRQMMYMADOJNM-NSCUHMNNSA-N |
| XLogP | 3.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|