C16H20F3NO3 — CID 119188017
4-methyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]pentanoic acid (PubChem CID 119188017) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 4-methyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119188017 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-methyl-2-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)CC(c1ccccc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H20F3NO3/c1-10(2)8-13(15(22)23)20-14(21)9-12(16(17,18)19)11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | LLMNXVBLRJBVQO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |