C13H20N2O3S — CID 103308815
3-amino-N-(benzenesulfonyl)-4,4-dimethylpentanamide (PubChem CID 103308815) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-amino-N-(benzenesulfonyl)-4,4-dimethylpentanamide.
| Compound Name | 3-amino-N-(benzenesulfonyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 103308815 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-amino-N-(benzenesulfonyl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)C(N)CC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-13(2,3)11(14)9-12(16)15-19(17,18)10-7-5-4-6-8-10/h4-8,11H,9,14H2,1-3H3,(H,15,16) |
| InChIKey | CBCHAXGPEUFIGI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |