C9H13ClN2O3S — CID 90425402
N-(benzenesulfonyl)-2-(methylamino)acetamide;hydrochloride (PubChem CID 90425402) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-(benzenesulfonyl)-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 90425402 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | N-(benzenesulfonyl)-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C9H12N2O3S.ClH/c1-10-7-9(12)11-15(13,14)8-5-3-2-4-6-8;/h2-6,10H,7H2,1H3,(H,11,12);1H |
| InChIKey | JNXDGKYZYLPJAI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |