C17H18N2O6S2 — CID 135052084
N-(benzenesulfonyl)-N'-methyl-N'-(4-methylphenyl)sulfonylpropanediamide (PubChem CID 135052084) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N'-methyl-N'-(4-methylphenyl)sulfonylpropanediamide.
| Compound Name | N-(benzenesulfonyl)-N'-methyl-N'-(4-methylphenyl)sulfonylpropanediamide |
|---|---|
| PubChem CID | 135052084 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-(benzenesulfonyl)-N'-methyl-N'-(4-methylphenyl)sulfonylpropanediamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(=O)CC(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O6S2/c1-13-8-10-15(11-9-13)27(24,25)19(2)17(21)12-16(20)18-26(22,23)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,18,20) |
| InChIKey | OVBWOKLWOWIOCL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|