C11H14N2O4S — CID 101154406
N'-(benzenesulfonyl)-N'-methylbutanediamide (PubChem CID 101154406) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N'-methylbutanediamide.
| Compound Name | N'-(benzenesulfonyl)-N'-methylbutanediamide |
|---|---|
| PubChem CID | 101154406 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N'-(benzenesulfonyl)-N'-methylbutanediamide |
| SMILES | CN(C(=O)CCC(N)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O4S/c1-13(11(15)8-7-10(12)14)18(16,17)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,12,14) |
| InChIKey | PXFHLHFMBZPPBD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |