C22H22N2O7S3 — CID 91086807
1,1,3-tris-(4-methylphenyl)sulfonylurea (PubChem CID 91086807) has the molecular formula C22H22N2O7S3 and a molecular weight of 522.63 g/mol. Its IUPAC name is 1,1,3-tris-(4-methylphenyl)sulfonylurea.
| Compound Name | 1,1,3-tris-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 91086807 |
| Molecular Formula | C22H22N2O7S3 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1,1,3-tris-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N(S(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O7S3/c1-16-4-10-19(11-5-16)32(26,27)23-22(25)24(33(28,29)20-12-6-17(2)7-13-20)34(30,31)21-14-8-18(3)9-15-21/h4-15H,1-3H3,(H,23,25) |
| InChIKey | ZNKAVOGDQDKXEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |