C24H28N2O5S2 — CID 10648709
1-(1-cyclohexylprop-2-ynyl)-1,3-bis-(4-methylphenyl)sulfonylurea (PubChem CID 10648709) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1-(1-cyclohexylprop-2-ynyl)-1,3-bis-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-(1-cyclohexylprop-2-ynyl)-1,3-bis-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 10648709 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1-(1-cyclohexylprop-2-ynyl)-1,3-bis-(4-methylphenyl)sulfonylurea |
| SMILES | C#CC(C1CCCCC1)N(C(=O)NS(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O5S2/c1-4-23(20-8-6-5-7-9-20)26(33(30,31)22-16-12-19(3)13-17-22)24(27)25-32(28,29)21-14-10-18(2)11-15-21/h1,10-17,20,23H,5-9H2,2-3H3,(H,25,27) |
| InChIKey | DSYJAESLEPSQLY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|