C21H24ClN3O6S2 — CID 3255121
3-[(4-chlorophenyl)sulfonylcarbamoyl]-1-cyclohexyl-1-(4-methylphenyl)sulfonylurea (PubChem CID 3255121) has the molecular formula C21H24ClN3O6S2 and a molecular weight of 514.03 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylcarbamoyl]-1-cyclohexyl-1-(4-methylphenyl)sulfonylurea.
| Compound Name | 3-[(4-chlorophenyl)sulfonylcarbamoyl]-1-cyclohexyl-1-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 3255121 |
| Molecular Formula | C21H24ClN3O6S2 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylcarbamoyl]-1-cyclohexyl-1-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)NC(=O)NS(=O)(=O)c2ccc(Cl)cc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O6S2/c1-15-7-11-19(12-8-15)33(30,31)25(17-5-3-2-4-6-17)21(27)23-20(26)24-32(28,29)18-13-9-16(22)10-14-18/h7-14,17H,2-6H2,1H3,(H2,23,24,26,27) |
| InChIKey | ZBGYLTCLISXGEY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |