C17H25N3O4S — CID 23800118
1-cyclohexyl-3-[(2,4-dimethylphenyl)carbamoyl]-1-methylsulfonylurea (PubChem CID 23800118) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2,4-dimethylphenyl)carbamoyl]-1-methylsulfonylurea.
| Compound Name | 1-cyclohexyl-3-[(2,4-dimethylphenyl)carbamoyl]-1-methylsulfonylurea |
|---|---|
| PubChem CID | 23800118 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-cyclohexyl-3-[(2,4-dimethylphenyl)carbamoyl]-1-methylsulfonylurea |
| SMILES | Cc1ccc(NC(=O)NC(=O)N(C2CCCCC2)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-12-9-10-15(13(2)11-12)18-16(21)19-17(22)20(25(3,23)24)14-7-5-4-6-8-14/h9-11,14H,4-8H2,1-3H3,(H2,18,19,21,22) |
| InChIKey | HYECLYHXSWUVJI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |