C16H24N2O2 — CID 96569546
1-(2,4-dimethylphenyl)-3-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]urea (PubChem CID 96569546) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 96569546 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H]2CCCC[C@H]2CO)c(C)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-11-7-8-14(12(2)9-11)17-16(20)18-15-6-4-3-5-13(15)10-19/h7-9,13,15,19H,3-6,10H2,1-2H3,(H2,17,18,20)/t13-,15-/m0/s1 |
| InChIKey | IQHAGQQHSHAHIP-ZFWWWQNUSA-N |
| XLogP | 2.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |