C17H26N2O3 — CID 96525276
1-(4-ethoxy-2-methylphenyl)-3-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]urea (PubChem CID 96525276) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(4-ethoxy-2-methylphenyl)-3-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-(4-ethoxy-2-methylphenyl)-3-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 96525276 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(4-ethoxy-2-methylphenyl)-3-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]urea |
| SMILES | CCOc1ccc(NC(=O)N[C@@H]2CCCC[C@H]2CO)c(C)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-22-14-8-9-15(12(2)10-14)18-17(21)19-16-7-5-4-6-13(16)11-20/h8-10,13,16,20H,3-7,11H2,1-2H3,(H2,18,19,21)/t13-,16+/m0/s1 |
| InChIKey | USLMYNWKEOCNTE-XJKSGUPXSA-N |
| XLogP | 3.07 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |