C13H16Cl2N2O2 — CID 103709932
1-(2,5-dichlorophenyl)-3-[2-(hydroxymethyl)cyclopentyl]urea (PubChem CID 103709932) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[2-(hydroxymethyl)cyclopentyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[2-(hydroxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 103709932 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[2-(hydroxymethyl)cyclopentyl]urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)NC1CCCC1CO |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-9-4-5-10(15)12(6-9)17-13(19)16-11-3-1-2-8(11)7-18/h4-6,8,11,18H,1-3,7H2,(H2,16,17,19) |
| InChIKey | WNEHLGBNBMHNGF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |