C16H22N2O — CID 108912475
1-(cyclohexylidenemethyl)-3-(2,4-dimethylphenyl)urea (PubChem CID 108912475) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-(cyclohexylidenemethyl)-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-(cyclohexylidenemethyl)-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108912475 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(cyclohexylidenemethyl)-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC=C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-8-9-15(13(2)10-12)18-16(19)17-11-14-6-4-3-5-7-14/h8-11H,3-7H2,1-2H3,(H2,17,18,19) |
| InChIKey | COAKNJHBWHLWPD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |