C14H15F3N2O — CID 108912672
1-(cyclohexylidenemethyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108912672) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-(cyclohexylidenemethyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(cyclohexylidenemethyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108912672 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-(cyclohexylidenemethyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(NC=C1CCCCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H15F3N2O/c15-10-6-7-11(13(17)12(10)16)19-14(20)18-8-9-4-2-1-3-5-9/h6-8H,1-5H2,(H2,18,19,20) |
| InChIKey | SEFGMCHVEQCBLW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|