C12H13F3N2O2 — CID 111437480
1-[(1-hydroxycyclobutyl)methyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 111437480) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 1-[(1-hydroxycyclobutyl)methyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[(1-hydroxycyclobutyl)methyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111437480 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(1-hydroxycyclobutyl)methyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(NCC1(O)CCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H13F3N2O2/c13-7-2-3-8(10(15)9(7)14)17-11(18)16-6-12(19)4-1-5-12/h2-3,19H,1,4-6H2,(H2,16,17,18) |
| InChIKey | XCICNUIKJNUHDP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|