C13H16F2N2O3 — CID 110936339
1-(2,3-difluorophenyl)-3-[(4-hydroxyoxan-4-yl)methyl]urea (PubChem CID 110936339) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3-[(4-hydroxyoxan-4-yl)methyl]urea.
| Compound Name | 1-(2,3-difluorophenyl)-3-[(4-hydroxyoxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 110936339 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3-[(4-hydroxyoxan-4-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CCOCC1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H16F2N2O3/c14-9-2-1-3-10(11(9)15)17-12(18)16-8-13(19)4-6-20-7-5-13/h1-3,19H,4-8H2,(H2,16,17,18) |
| InChIKey | XTJZHYRFRJBFJG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |