C16H22NO4S- — CID 2095447
2-[cycloheptyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 2095447) has the molecular formula C16H22NO4S- and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[cycloheptyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | 2-[cycloheptyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 2095447 |
| Molecular Formula | C16H22NO4S- |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[cycloheptyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)[O-])C2CCCCCC2)cc1 |
| InChI | InChI=1S/C16H23NO4S/c1-13-8-10-15(11-9-13)22(20,21)17(12-16(18)19)14-6-4-2-3-5-7-14/h8-11,14H,2-7,12H2,1H3,(H,18,19)/p-1 |
| InChIKey | POEIYXJVTHUVKI-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |