C22H28ClNO2S — CID 155937368
N-[(2R)-2-chloro-2-(4-methylphenyl)ethyl]-N-cyclohexyl-4-methylbenzenesulfonamide (PubChem CID 155937368) has the molecular formula C22H28ClNO2S and a molecular weight of 405.99 g/mol. Its IUPAC name is N-[(2R)-2-chloro-2-(4-methylphenyl)ethyl]-N-cyclohexyl-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-chloro-2-(4-methylphenyl)ethyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 155937368 |
| Molecular Formula | C22H28ClNO2S |
| Molecular Weight | 405.99 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(2R)-2-chloro-2-(4-methylphenyl)ethyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc([C@@H](Cl)CN(C2CCCCC2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H28ClNO2S/c1-17-8-12-19(13-9-17)22(23)16-24(20-6-4-3-5-7-20)27(25,26)21-14-10-18(2)11-15-21/h8-15,20,22H,3-7,16H2,1-2H3/t22-/m0/s1 |
| InChIKey | LPMZANUNCKHVCN-QFIPXVFZSA-N |
| XLogP | 5.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|