C16H23NO5S — CID 154782398
4-[cyclohexyl(2-hydroxypropyl)sulfamoyl]benzoic acid (PubChem CID 154782398) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[cyclohexyl(2-hydroxypropyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[cyclohexyl(2-hydroxypropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 154782398 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[cyclohexyl(2-hydroxypropyl)sulfamoyl]benzoic acid |
| SMILES | CC(O)CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-12(18)11-17(14-5-3-2-4-6-14)23(21,22)15-9-7-13(8-10-15)16(19)20/h7-10,12,14,18H,2-6,11H2,1H3,(H,19,20) |
| InChIKey | BFOSWOJYRIHJJZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |