C16H22NO6S- — CID 7414153
2-[cyclohexyl-(3,4-dimethoxyphenyl)sulfonylamino]acetate (PubChem CID 7414153) has the molecular formula C16H22NO6S- and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[cyclohexyl-(3,4-dimethoxyphenyl)sulfonylamino]acetate.
| Compound Name | 2-[cyclohexyl-(3,4-dimethoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7414153 |
| Molecular Formula | C16H22NO6S- |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[cyclohexyl-(3,4-dimethoxyphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)[O-])C2CCCCC2)cc1OC |
| InChI | InChI=1S/C16H23NO6S/c1-22-14-9-8-13(10-15(14)23-2)24(20,21)17(11-16(18)19)12-6-4-3-5-7-12/h8-10,12H,3-7,11H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | CVOPIVIDCVVLTL-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |